Introduction：Basic information about CAS 2872-66-4|b-D-Galactopyranoside,4-nitrophenyl, 2,3,4,6-tetraacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | b-D-Galactopyranoside,4-nitrophenyl, 2,3,4,6-tetraacetate |
|---|
| CAS Number | 2872-66-4 | Molecular Weight | 469.39600 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 559.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H23NO12 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.1ºC |
|---|
Names
| Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-nitrophenoxy)oxan-2-yl]methyl acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 559.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H23NO12 |
|---|
| Molecular Weight | 469.39600 |
|---|
| Flash Point | 207.1ºC |
|---|
| Exact Mass | 469.12200 |
|---|
| PSA | 169.48000 |
|---|
| LogP | 1.57990 |
|---|
| Vapour Pressure | 1.53E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | BEUISCKWILNFIL-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCC1OC(Oc2ccc([N+](=O)[O-])cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|---|
Synonyms
| p-Nitrophenyl 2,3,4,6-Tetra-O-acetyl-|A-D-galactopyranoside |
| (2R,3S,4S,5R,6S)-2-(acetoxymethyl)-6-(4-nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate |
| 4-nitrophenyl 2,3,4,6-tetra-o-acetyl-|A-d-galactopyranoside |
