Introduction：Basic information about CAS 6052-68-2|Lycoperodine 1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Lycoperodine 1 |
|---|
| CAS Number | 6052-68-2 | Molecular Weight | 216.23600 |
|---|
| Density | 1.377g/cm3 | Boiling Point | 485ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12N2O2 | Melting Point | 289ºC (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | 247.1ºC |
|---|
Names
| Name | 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.377g/cm3 |
|---|
| Boiling Point | 485ºC at 760 mmHg |
|---|
| Melting Point | 289ºC (dec.)(lit.) |
|---|
| Molecular Formula | C12H12N2O2 |
|---|
| Molecular Weight | 216.23600 |
|---|
| Flash Point | 247.1ºC |
|---|
| Exact Mass | 216.09000 |
|---|
| PSA | 65.12000 |
|---|
| LogP | 1.59560 |
|---|
| Index of Refraction | 1.692 |
|---|
| InChIKey | FSNCEEGOMTYXKY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1Cc2c([nH]c3ccccc23)CN1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,2,3,4-tetrahydrobeta-carboline-3-carboxylic acid |
| 2,3,4,9-Tetrahydro-1H-beta-Carboline-3-Carboxylic Acid |
| dl-1,2,3,4-tetrahydro-9H-pyrido<2,3,4,9-tetrahydro-1h-|A-carboline-3-carboxylic acid |
| D-1,2,3,4-tetrahydronorharman-3-carboxylic acid |
| 1H-Pyrido(3,4-b)indole-3-carboxylic acid,2,3,4,9-tetrahydro |
| 1H,2H,3H,4H,9H-pyrido[3,4-b]indole-3-carboxylic acid |
| 1,2,3,4-tetrahydro-9H-pyrido<3,4-b>indole-3-carboxylic acid |
| Lycoperodine 1 |
