Introduction：Basic information about CAS 4850-82-2|Benzenepropanoic acid, a-benzoyl-b-oxo-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenepropanoic acid, a-benzoyl-b-oxo-, ethyl ester |
|---|
| CAS Number | 4850-82-2 | Molecular Weight | 296.31700 |
|---|
| Density | 1.184g/cm3 | Boiling Point | 433ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.9ºC |
|---|
Names
| Name | ethyl 2-benzoyl-3-oxo-3-phenylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.184g/cm3 |
|---|
| Boiling Point | 433ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O4 |
|---|
| Molecular Weight | 296.31700 |
|---|
| Flash Point | 190.9ºC |
|---|
| Exact Mass | 296.10500 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 2.93150 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | JHWPTSCKSATEQK-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
|---|
Synonyms
| EINECS 225-442-3 |
| 2,2-Dibenzoyl-essigsaeure-ethylester |
| 2-Benzoyl-3-oxo-3-phenyl-propionsaeure-aethylester |
| Ethyl 2-benzoyl-3-oxo-3-phenylpropionate |
| Dibenzoylacetic acid,ethyl ester |
| Dibenzoylessigsaeure-aethylester |
| 2-benzoyl-3-oxo-3-phenyl-propionic acid ethyl ester |
| Dibenzoyl-essigsaeureethylester |
