Introduction：Basic information about CAS 2790-09-2|r-Cumidic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | r-Cumidic acid |
|---|
| CAS Number | 2790-09-2 | Molecular Weight | 194.18400 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 425.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10O4 | Melting Point | 298°C(lit.) |
|---|
| MSDS | / | Flash Point | 225.5ºC |
|---|
Names
| Name | 4,6-dimethylbenzene-1,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 425.8ºC at 760 mmHg |
|---|
| Melting Point | 298°C(lit.) |
|---|
| Molecular Formula | C10H10O4 |
|---|
| Molecular Weight | 194.18400 |
|---|
| Flash Point | 225.5ºC |
|---|
| Exact Mass | 194.05800 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.69980 |
|---|
| Vapour Pressure | 5.21E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | HAYIPGIFANTODX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(C(=O)O)cc1C(=O)O |
|---|
Safety Information
Synonyms
| 4,6-dimethyl-isophthalic acid |
| 4,6-dimethyl-1,3-benzenedicarboxylic acid |
| 4,6-Dimethylbenzol-1,3-dicarbonsaeure |
| 2,4-Dimethyl-isophthalsaeure |
| 4,6-Dimethyl-isophthalsaeure |
