Introduction：Basic information about CAS 10262-65-4|2-Bromoacetyl-6-methoxynaphtalene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromoacetyl-6-methoxynaphtalene |
|---|
| CAS Number | 10262-65-4 | Molecular Weight | 279.12900 |
|---|
| Density | 1.451 g/cm3 | Boiling Point | 387.2ºCat 760 mmHg |
|---|
| Molecular Formula | C13H11BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 188ºC |
|---|
Names
| Name | 2-bromo-1-(6-methoxynaphthalen-2-yl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.451 g/cm3 |
|---|
| Boiling Point | 387.2ºCat 760 mmHg |
|---|
| Molecular Formula | C13H11BrO2 |
|---|
| Molecular Weight | 279.12900 |
|---|
| Flash Point | 188ºC |
|---|
| Exact Mass | 277.99400 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.42600 |
|---|
| Vapour Pressure | 3.35E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | HHHKEQGAGUAOQI-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2cc(C(=O)CBr)ccc2c1 |
|---|
Safety Information
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 6-methoxy-2-(bromoacetyl)naphthalene |
| Ethanone,2-bromo-1-(6-methoxy-2-naphthalenyl) |
| 2-bromo-1-(6-methoxy-[2]naphthyl)-ethanone |
| 2-Bromoacetyl-6-methoxynaphtalene |
| 2-Bromo-6'-methoxy-2'-acetonaphthone |
| 2-bromo-6'-methoxy-2'-acetonaphthone |
| 2-(3-ETHOXYPHENOXY)ANILINE |
| 2-(BroMoacetyl)-6-Methoxynaphthalene |
| 2-(Bromoacetyl)-6-methoxynaphthalene |
| 2-bromo-1-(2-methoxynaphthalen-6-yl)ethanone |
