Introduction:Basic information about CAS 66710-97-2|ethoxylated tetrabromo bisphenol ''a'' diacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethoxylated tetrabromo bisphenol ''a'' diacrylate |
|---|
| CAS Number | 66710-97-2 | Molecular Weight | 276.41400 |
|---|
| Density | 1.664g/cm3 | Boiling Point | 645.7ºC at 760 mmHg |
|---|
| Molecular Formula | C18H28O2 | Melting Point | 136-138ºC |
|---|
| MSDS | / | Flash Point | 344.3ºC |
|---|
Names
| Name | ethoxylated tetrabromo bisphenol ''a'' diacrylate |
|---|
Chemical & Physical Properties
| Density | 1.664g/cm3 |
|---|
| Boiling Point | 645.7ºC at 760 mmHg |
|---|
| Melting Point | 136-138ºC |
|---|
| Molecular Formula | C18H28O2 |
|---|
| Molecular Weight | 276.41400 |
|---|
| Flash Point | 344.3ºC |
|---|
| Exact Mass | 276.20900 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 4.90620 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | OOGPFCFGQOSOOZ-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)OCCOc1c(Br)cc(C(C)(C)c2cc(Br)c(OCCOC(=O)C=C)c(Br)c2)cc1Br |
|---|
Safety Information