Introduction：Basic information about CAS 669713-82-0|3',5'-Dichloro-2-biphenylcarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3',5'-Dichloro-2-biphenylcarboxylic acid |
|---|
| CAS Number | 669713-82-0 | Molecular Weight | 267.107 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 402.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H8Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.0±24.6 °C |
|---|
Names
| Name | 2-(3,5-dichlorophenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 402.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H8Cl2O2 |
|---|
| Molecular Weight | 267.107 |
|---|
| Flash Point | 197.0±24.6 °C |
|---|
| Exact Mass | 265.990143 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.14 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | BTDOPVCRCNGVQW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1-c1cc(Cl)cc(Cl)c1 |
|---|
Synonyms
| 3',5'-Dichlorobiphenyl-2-carboxylic acid |
| 2-Biphenyl-3',5'-dichloro-carboxylicacid |
| 3',5'-Dichloro-biphenyl-2-carboxylic acid |
| 3',5'-Dichloro-2-biphenylcarboxylic acid |
| [1,1'-Biphenyl]-2-carboxylic acid, 3',5'-dichloro- |
