Introduction：Basic information about CAS 68697-61-0|DL-Tyrosine Methyl Ester Hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DL-Tyrosine Methyl Ester Hydrochloride |
|---|
| CAS Number | 68697-61-0 | Molecular Weight | 231.67600 |
|---|
| Density | / | Boiling Point | 330ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 153.4ºC |
|---|
Names
| Name | Methyl 2-amino-3-(4-hydroxyphenyl)propanoate hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 330ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14ClNO3 |
|---|
| Molecular Weight | 231.67600 |
|---|
| Flash Point | 153.4ºC |
|---|
| Exact Mass | 231.06600 |
|---|
| PSA | 72.55000 |
|---|
| LogP | 1.93730 |
|---|
| InChIKey | VXYFARNRGZWHTJ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(N)Cc1ccc(O)cc1.Cl |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922509090 |
|---|
Customs
| HS Code | 2922509090 |
|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Tyrosine,methyl ester |
| (D,L)-Tyr methyl ester hydrochloride |
| methyl tyrosinate hydrochloride |
| tyrosine methyl ester hydrochloride |
| L-tyrosine methyl ester HCl salt |
| Tyr(OMe) hydrochloride |
| DL-tyrosine methyl ester hydrochloride |
| DL-Tyr-O-Me hydrochloride |
| Tyr-OMe |
| L-Tyrosine,methyl ester |
| D,L-tyrosine methyl ester |
| methyl tyrosinate |
| D,L-Tyr-OMe |
| H-DL-Tyr-Ome.HCl |
