Introduction:Basic information about CAS 6872-57-7|Nitidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nitidine |
|---|
| CAS Number | 6872-57-7 | Molecular Weight | 383.825 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C21H18ClNO4 | Melting Point | 281-283ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,3-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 281-283ºC |
|---|
| Molecular Formula | C21H18ClNO4 |
|---|
| Molecular Weight | 383.825 |
|---|
| Exact Mass | 383.092438 |
|---|
| PSA | 40.80000 |
|---|
| LogP | 3.71660 |
|---|
| InChIKey | KKMPSGJPCCJYRV-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2c[n+](C)c3c4cc5c(cc4ccc3c2cc1OC)OCO5 |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,3-Dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridinium chloride |
| [1,3]Benzodioxolo[5,6-c]phenanthridinium, 2,3-dimethoxy-12-methyl-, chloride (1:1) |
| 2,3-Dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium chloride |
| (1,3)Benzodioxolo(5,6-c)phenanthridinium,2,3-dimethoxy-12-methyl |
| 2,3-Dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
| [1,3]Benzodioxolo[5,6-c]phenanthridinium, 2,3-dimethoxy-12-methyl- |
| NitidineChloride |
| Nitidine chloride |
| 2,3-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium,chloride |
| (1,3)Benzodioxolo(5,6-c)phenanthridinium, 2,3-dimethoxy-12-methyl- |
| Nitidine |