Introduction：Basic information about CAS 69891-44-7|(R)-(-)-2-(P-TOLUENESULFONATE)-1,2-PROPANOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-(-)-2-(P-TOLUENESULFONATE)-1,2-PROPANOL |
|---|
| CAS Number | 69891-44-7 | Molecular Weight | 230.28100 |
|---|
| Density | 1.246g/cm3 | Boiling Point | 379.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.3ºC |
|---|
Names
| Name | [(2R)-1-hydroxypropan-2-yl] 4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.246g/cm3 |
|---|
| Boiling Point | 379.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14O4S |
|---|
| Molecular Weight | 230.28100 |
|---|
| Flash Point | 183.3ºC |
|---|
| Exact Mass | 230.06100 |
|---|
| PSA | 71.98000 |
|---|
| LogP | 2.16190 |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | UADUJNAWMVEFHR-SECBINFHSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OC(C)CO)cc1 |
|---|
Synonyms
| R-2-(4-Methylbenzenesulfonyloxy)-1-propanol |
| (R)-(-)-2-(p-toluenesulfonate)-1,2-Propaniol |
| (R)-2-(((4-methylphenyl)sulfonyl)oxy)-1-propanol |
