Introduction：Basic information about CAS 32677-47-7|furan-2,5-dione compound with propane-1,2-diol and 3a,4,7,7a-tetrahydro-1H-4,7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | furan-2,5-dione compound with propane-1,2-diol and 3a,4,7,7a-tetrahydro-1H-4,7-methanoindene (1:1:1) |
|---|
| CAS Number | 32677-47-7 | Molecular Weight | 306.35400 |
|---|
| Density | / | Boiling Point | 170ºC at 760mmHg |
|---|
| Molecular Formula | C17H22O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 46.8ºC |
|---|
Names
| Name | furan-2,5-dione compound with propane-1,2-diol and 3a,4,7,7a-tetrahydro-1H-4,7-methanoindene (1:1:1) |
|---|
Chemical & Physical Properties
| Boiling Point | 170ºC at 760mmHg |
|---|
| Molecular Formula | C17H22O5 |
|---|
| Molecular Weight | 306.35400 |
|---|
| Flash Point | 46.8ºC |
|---|
| Exact Mass | 306.14700 |
|---|
| PSA | 83.83000 |
|---|
| LogP | 1.37010 |
|---|
| InChIKey | KCRQNTINBSSIMH-UHFFFAOYSA-N |
|---|
| SMILES | C1=CC2C3C=CC(C3)C2C1.CC(O)CO.O=C1C=CC(=O)O1 |
|---|
