Introduction:Basic information about CAS 86662-54-6|Binizolast, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Binizolast |
|---|
| CAS Number | 86662-54-6 | Molecular Weight | 325.40800 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 544.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N5O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.1ºC |
|---|
Names
| Name | 1-(1-Piperidinylmethyl)-4-propyl[1,2,4]triazolo[4,3-a]quinazolin- 5(4H)-one |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 544.5ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N5O |
|---|
| Molecular Weight | 325.40800 |
|---|
| Flash Point | 283.1ºC |
|---|
| Exact Mass | 325.19000 |
|---|
| PSA | 55.43000 |
|---|
| LogP | 2.37800 |
|---|
| Index of Refraction | 1.687 |
|---|
| InChIKey | FFDDIHIPHFAQIN-UHFFFAOYSA-N |
|---|
| SMILES | CCCn1c(=O)c2ccccc2n2c(CN3CCCCC3)nnc12 |
|---|