Introduction:Basic information about CAS 102908-59-8|Binospirone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Binospirone |
|---|
| CAS Number | 102908-59-8 | Molecular Weight | 358.43100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 553.6ºC at 760mmHg |
|---|
| Molecular Formula | C20H26N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 288.6ºC |
|---|
Names
| Name | 8-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)ethyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 553.6ºC at 760mmHg |
|---|
| Molecular Formula | C20H26N2O4 |
|---|
| Molecular Weight | 358.43100 |
|---|
| Flash Point | 288.6ºC |
|---|
| Exact Mass | 358.18900 |
|---|
| PSA | 67.87000 |
|---|
| LogP | 2.45420 |
|---|
| Vapour Pressure | 2.67E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | BVMYCHKQPGEOSI-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCNCC1COc2ccccc2O1 |
|---|
Synonyms
| Binospirone [INN] |
| UNII-T3M5D109V5 |
| Binospirone |