Introduction:Basic information about CAS 761404-85-7|Trityl Olmesartan Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trityl Olmesartan Acid |
|---|
| CAS Number | 761404-85-7 | Molecular Weight | 688.816 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 901.0±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C43H40N6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 498.7±37.1 °C |
|---|
Names
| Name | Trityl Olmesartan Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 901.0±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C43H40N6O3 |
|---|
| Molecular Weight | 688.816 |
|---|
| Flash Point | 498.7±37.1 °C |
|---|
| Exact Mass | 688.316162 |
|---|
| PSA | 118.95000 |
|---|
| LogP | 8.85 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | WBRMIXBFMUWHHX-UHFFFAOYSA-N |
|---|
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)O)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|---|
Synonyms
| 4-(2-Hydroxy-2-propanyl)-2-propyl-1-{[2'-(1-trityl-1H-tetrazol-5-yl)-4-biphenylyl]methyl}-1H-imidazole-5-carboxylic acid |
| trityl olmesartan |
| 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
| 1H-Imidazole-5-carboxylic acid, 4-(1-hydroxy-1-methylethyl)-2-propyl-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]- |
| IMI060 |
| OMST-B |