CAS 10118-56-6|Cascarillin
Introduction：Basic information about CAS 10118-56-6|Cascarillin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cascarillin | ||
|---|---|---|---|
| CAS Number | 10118-56-6 | Molecular Weight | 408.48500 |
| Density | 1.25g/cm3 | Boiling Point | 457.5ºC at 760mmHg |
| Molecular Formula | C22H32O7 | Melting Point | / |
| MSDS | / | Flash Point | 230.5ºC |
Names
| Name | [(2R,3S,4S,4aS,7R,8R,8aR)-4-formyl-4-[(2R)-2-(furan-3-yl)-2-hydroxyethyl]-7,8-dihydroxy-3,8,8a-trimethyl-2,3,4a,5,6,7-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 457.5ºC at 760mmHg |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.48500 |
| Flash Point | 230.5ºC |
| Exact Mass | 408.21500 |
| PSA | 117.20000 |
| LogP | 2.38810 |
| Vapour Pressure | 3.66E-09mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | ZOWKQQIGQBVKSV-BZLLESMPSA-N |
| SMILES | CC(=O)OC1CC2(C)C(CCC(O)C2(C)O)C(C=O)(CC(O)c2ccoc2)C1C |
Synonyms
| (4aR)-2,4a,5,6,7,8-hexahydro-3,5,5,9-tetramethyl-1H-benzocycloheptene |
| (4aR)-3c-Acetoxy-1t-((R)-2-[3]furyl-2-hydroxy-aethyl)-5t,6c-dihydroxy-2c,4a,5c-trimethyl-(4ar,8at)-decahydro-[1c]naphthaldehyd |
| (4aR)-3c-acetoxy-1t-((R)-2-[3]furyl-2-hydroxy-ethyl)-5t,6c-dihydroxy-2c,4a,5c-trimethyl-(4ar,8at)-decahydro-[1c]naphthaldehyde |
| 1H-Benzocycloheptene,2,4a,5,6,7,8-hexahydro-3,5,5,9-tetramethyl-,(R) |
| (4aR)-3,5,5,9-tetramethyl-2,4a,5,6,7,8-hexahydro-1H-benzocycloheptene |
| 3,5,5,9-tetramethyl-2,4a,5,6,7,8-hexahydro-1H-benzo[7]annulene |
| (R)-2,4a,5,6,7,8-hexahydro-3,5,5,9-tetramethyl-1H-benzocycloheptene |
| (6xi)-himachal-1(11),4-diene |
| carillin |
| Himachalene |
| (4aR)-3,5,5,9-Tetramethyl-2,4a,5,6,7,8-hexahydro-1H-benzocyclohepten |
