Introduction:Basic information about CAS 103427-73-2|ssh-108, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ssh-108 |
|---|
| CAS Number | 103427-73-2 | Molecular Weight | 277.33700 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 373.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H17F2N5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179.8ºC |
|---|
Names
| Name | fucaojing |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 373.8ºC at 760mmHg |
|---|
| Molecular Formula | C10H17F2N5S |
|---|
| Molecular Weight | 277.33700 |
|---|
| Flash Point | 179.8ºC |
|---|
| Exact Mass | 277.11700 |
|---|
| PSA | 94.49000 |
|---|
| LogP | 1.67070 |
|---|
| Vapour Pressure | 8.76E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | NWUJLIRYNYNDAJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)Nc1nc(NC(C)C)nc(SC(F)F)n1 |
|---|
Synonyms
| 6-[(difluoromethyl)thio]-N,N’-bis(1-methylethyl)-1,3,5-triazine-2,4-diamine |
| UNII-OEG51E95N3 |
| 6-(difluoromethylsulfanyl)-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| 6-(difluoromethylthio)-N2,N4-diisopropyl-1,3,5-triazine-2,4-diamine |
| 6-[(difluoromethyl)sulfanyl]-N2,N4-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |