Introduction：Basic information about CAS 604-61-5|Benzoic acid,2-benzoyl-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,2-benzoyl-, ethyl ester |
|---|
| CAS Number | 604-61-5 | Molecular Weight | 254.28100 |
|---|
| Density | 1.145g/cm3 | Boiling Point | 365.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.3ºC |
|---|
Names
| Name | ethyl 2-benzoylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145g/cm3 |
|---|
| Boiling Point | 365.6ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O3 |
|---|
| Molecular Weight | 254.28100 |
|---|
| Flash Point | 160.3ºC |
|---|
| Exact Mass | 254.09400 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.09430 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | CGWFVEFHQWJOKI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccccc1C(=O)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2914509090 |
|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-Benzoyl-benzoesaeure-aethylester |
| Ketonone E |
| 2-Carbethoxybenzophenone |
| Ethyl o-benzoylbenzoate |
| ethyl 2-(phenylcarbonyl)benzoate |
| 2-carboethoxybenzophenone |
| o-Benzoylbenzoic acid,ethyl ester |
| 2-benzoyl-benzoic acid ethyl ester |
