Introduction:Basic information about CAS 22952-32-5|5-Chloro-2-methoxybenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-2-methoxybenzenesulfonyl chloride |
|---|
| CAS Number | 22952-32-5 | Molecular Weight | 241.092 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 344.6±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6Cl2O3S | Melting Point | 100-104 °C |
|---|
| MSDS | USA | Flash Point | 162.2±25.1 °C |
|---|
Names
| Name | 5-chloro-2-methoxybenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 344.6±32.0 °C at 760 mmHg |
|---|
| Melting Point | 100-104 °C |
|---|
| Molecular Formula | C7H6Cl2O3S |
|---|
| Molecular Weight | 241.092 |
|---|
| Flash Point | 162.2±25.1 °C |
|---|
| Exact Mass | 239.941467 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 2.96 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.550 |
|---|
| InChIKey | FCJGLIMDVOTBLO-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Cl |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S8-S45-S36/37/39-S26 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2909309090 |
|---|
Preparation
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 5-Chloro-2-methoxybenzenesulphonyl chloride |
| 2-methoxy-5-chlorophenylsulfonyl chloride |
| 5-Chloro-2-methoxybenzenesulfonyl chloride |
| 5-chloro-2-methoxyphenylsulfonyl chloride |
| MFCD00052959 |
| 5-chloro-2-methoxybenzene-1-sulfonyl chloride |
| 5-chloro-2-methoxybenzene sulfonyl chloride |
| Benzenesulfonyl chloride, 5-chloro-2-methoxy- |