Introduction：Basic information about CAS 66131-14-4|5,5-DIBROMOMELDRUM'S ACID; >98, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,5-DIBROMOMELDRUM'S ACID; >98 |
|---|
| CAS Number | 66131-14-4 | Molecular Weight | 301.91700 |
|---|
| Density | 2.052g/cm3 | Boiling Point | 382.323ºC at 760 mmHg |
|---|
| Molecular Formula | C6H6Br2O4 | Melting Point | 75ºC |
|---|
| MSDS | / | Flash Point | 185.023ºC |
|---|
Names
| Name | 5,5-dibromo-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.052g/cm3 |
|---|
| Boiling Point | 382.323ºC at 760 mmHg |
|---|
| Melting Point | 75ºC |
|---|
| Molecular Formula | C6H6Br2O4 |
|---|
| Molecular Weight | 301.91700 |
|---|
| Flash Point | 185.023ºC |
|---|
| Exact Mass | 299.86300 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.30860 |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | HPBNIRVIOCWRDC-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OC(=O)C(Br)(Br)C(=O)O1 |
|---|
| Storage condition | -20°C |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| 5,5-dibromo-2,2-dimethyl-4,6-dioxy-1,3-dioxane |
| 2,2-dimethyl-5,5-dibromo-1,3-dioxane-4,6-dione |
| 5,5-Dibrom-2,2-dimethyl-4,6-dioxo-1,3-dioxin |
| 5,5-dibromo-2,2-dimethyl-4,6-dioxo-1,3-dioxane |
| cycl-Isopropylidene Dibromomalonate |
| 5-dibromo-2,2-dimethyl-[1,3]dioxane-4,6-dione |
| 5,5-dibromo-Meldrum's acid |
