Introduction：Basic information about CAS 661459-05-8|3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
|---|
| CAS Number | 661459-05-8 | Molecular Weight | 243.299 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 359.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H21NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.2±25.9 °C |
|---|
Names
| Name | 3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 359.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H21NO4 |
|---|
| Molecular Weight | 243.299 |
|---|
| Flash Point | 171.2±25.9 °C |
|---|
| Exact Mass | 243.147064 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 1.62 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.486 |
|---|
| InChIKey | OBOHPFVTEILYQF-UHFFFAOYSA-N |
|---|
| SMILES | CC1CCCN(C(=O)OC(C)(C)C)C1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Boc-3-methylpipecolinic acid |
| 1-(tert-Butoxycarbonyl)-3-methylpiperidine-2-carboxylic acid |
| 3-methyl-piperidine-1,2-dicarboxylic acid 1-tert-butyl ester |
| 1,2-Piperidinedicarboxylic acid, 3-methyl-, 1-(1,1-dimethylethyl) ester |
| 1,3-Piperidinedicarboxylic acid, 3-methyl-, 1-(1,1-dimethylethyl) ester |
| 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid |
| 1-(tert-butoxycarbonyl)-3-methylpiperidine-3-carboxylic acid |
| 3-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid |
| 3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
