Introduction：Basic information about CAS 885274-60-2|2-(4-Boc-piperazinyl)-α-(3,4-dichloro-phenyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Boc-piperazinyl)-α-(3,4-dichloro-phenyl)acetic acid |
|---|
| CAS Number | 885274-60-2 | Molecular Weight | 389.27400 |
|---|
| Density | 1.343g/cm3 | Boiling Point | 485.448°C at 760 mmHg |
|---|
| Molecular Formula | C17H22Cl2N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.391°C |
|---|
Names
| Name | 4-[carboxy-(3,4-dichloro-phenyl)-methyl]-piperazine-1-carboxylic acid tert-butyl ester hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.343g/cm3 |
|---|
| Boiling Point | 485.448°C at 760 mmHg |
|---|
| Molecular Formula | C17H22Cl2N2O4 |
|---|
| Molecular Weight | 389.27400 |
|---|
| Flash Point | 247.391°C |
|---|
| Exact Mass | 388.09600 |
|---|
| PSA | 70.08000 |
|---|
| LogP | 3.54760 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | HPZXIWOTSJKSMY-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C(=O)O)c2ccc(Cl)c(Cl)c2)CC1 |
|---|
Synonyms
| 2-(4-Boc-piperazinyl)-α-(3,4-dichloro-phenyl)acetic acid |
| (3,4-Dichlorophenyl)(4-{[(2-methyl-2-propanyl)oxy]carbonyl}-1-piperazinyl)acetic acid |
