Introduction：Basic information about CAS 62669-74-3|Coumarin 138, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Coumarin 138 |
|---|
| CAS Number | 62669-74-3 | Molecular Weight | 229.27400 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 426.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.9ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 426.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO2 |
|---|
| Molecular Weight | 229.27400 |
|---|
| Flash Point | 173.9ºC |
|---|
| Exact Mass | 229.11000 |
|---|
| PSA | 33.45000 |
|---|
| LogP | 2.34770 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | RIUSGHALMCFISX-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc2c3c(c(=O)oc2c1)CCC3 |
|---|
