Introduction:Basic information about CAS 119-23-3|Benzene,1,4-diethoxy-2-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1,4-diethoxy-2-nitro- |
|---|
| CAS Number | 119-23-3 | Molecular Weight | 211.21500 |
|---|
| Density | 1.158g/cm3 | Boiling Point | 169 °C13 mm Hg(lit.) |
|---|
| Molecular Formula | C10H13NO4 | Melting Point | 48-51 °C(lit.) |
|---|
| MSDS | / | Flash Point | >230 °F |
|---|
Names
| Name | 1,4-Diethoxy-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.158g/cm3 |
|---|
| Boiling Point | 169 °C13 mm Hg(lit.) |
|---|
| Melting Point | 48-51 °C(lit.) |
|---|
| Molecular Formula | C10H13NO4 |
|---|
| Molecular Weight | 211.21500 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 211.08400 |
|---|
| PSA | 64.28000 |
|---|
| LogP | 2.91540 |
|---|
| Vapour Pressure | 0.0011mmHg at 25°C |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | AUCRWWWSFGZHBK-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(OCC)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 2 |
|---|
Synonyms
| EINECS 204-308-8 |
| 2,5-Diethoxynitrobenzene |
| 1,4-DIETHOXY-2-NITROBENZENE |
| MFCD00007100 |
| 1,4-Diethoxy-2-nitro-benzene |