Introduction:Basic information about CAS 175276-81-0|{[3-(Trifluoromethyl)benzyl]sulfonyl}acetonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | {[3-(Trifluoromethyl)benzyl]sulfonyl}acetonitrile |
|---|
| CAS Number | 175276-81-0 | Molecular Weight | 263.236 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 416.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8F3NO2S | Melting Point | 119 °C |
|---|
| MSDS | / | Flash Point | 205.5±28.7 °C |
|---|
Names
| Name | 2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]acetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 416.1±45.0 °C at 760 mmHg |
|---|
| Melting Point | 119 °C |
|---|
| Molecular Formula | C10H8F3NO2S |
|---|
| Molecular Weight | 263.236 |
|---|
| Flash Point | 205.5±28.7 °C |
|---|
| Exact Mass | 263.022797 |
|---|
| PSA | 66.31000 |
|---|
| LogP | 1.24 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.494 |
|---|
| InChIKey | MXAFRLGCENSSSL-UHFFFAOYSA-N |
|---|
| SMILES | N#CCS(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
|---|
Safety Information
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | S22-S36/37/39 |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-[[[3-(Trifluoromethyl)Phenyl]Methyl]Sulfonyl]-Acetonitrile |
| Acetonitrile, 2-[[[3-(trifluoromethyl)phenyl]methyl]sulfonyl]- |
| MFCD00173822 |
| 2-{[3-(trifluoromethyl)benzyl]sulfonyl}acetonitrile |
| 2-((3-(Trifluoromethyl)benzyl)sulfonyl)acetonitrile |
| {[3-(Trifluoromethyl)benzyl]sulfonyl}acetonitrile |
| 3-trifluoromethylbenzylsulfonylacetonitrile |