Introduction:Basic information about CAS 1724-17-0|Methyl oleanolate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl oleanolate |
|---|
| CAS Number | 1724-17-0 | Molecular Weight | 470.727 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 526.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C31H50O3 | Melting Point | 200-205ºC |
|---|
| MSDS | / | Flash Point | 190.7±22.9 °C |
|---|
Names
| Name | methyl (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 526.1±50.0 °C at 760 mmHg |
|---|
| Melting Point | 200-205ºC |
|---|
| Molecular Formula | C31H50O3 |
|---|
| Molecular Weight | 470.727 |
|---|
| Flash Point | 190.7±22.9 °C |
|---|
| Exact Mass | 470.376007 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 9.52 |
|---|
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | BTXWOKJOAGWCSN-JBYJGCOVSA-N |
|---|
| SMILES | COC(=O)C12CCC(C)(C)CC1C1=CCC3C4(C)CCC(O)C(C)(C)C4CCC3(C)C1(C)CC2 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 22-36/37/39 |
|---|
Synonyms
| (4aS,6aS,6bR,10S,12aR)-methyl 10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylate |
| Olean-12-en-28-oic acid, 3-hydroxy-, methyl ester, (3β)- |
| Oleanolic acid methyl ester |
| MFCD00017382 |
| methyl oleanoate |
| Methyl (3β)-3-hydroxyolean-12-en-28-oate |
| EINECS 217-029-1 |
| methyl oleanate |
| Methyl oleanolate |