Introduction：Basic information about CAS 22184-97-0|3-(morpholinosulfonyl)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(morpholinosulfonyl)aniline |
|---|
| CAS Number | 22184-97-0 | Molecular Weight | 242.295 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 456.6±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H14N2O3S | Melting Point | 132ºC |
|---|
| MSDS | USA | Flash Point | 229.9±31.5 °C |
|---|
Names
| Name | 3-morpholin-4-ylsulfonylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 456.6±55.0 °C at 760 mmHg |
|---|
| Melting Point | 132ºC |
|---|
| Molecular Formula | C10H14N2O3S |
|---|
| Molecular Weight | 242.295 |
|---|
| Flash Point | 229.9±31.5 °C |
|---|
| Exact Mass | 242.072510 |
|---|
| PSA | 81.01000 |
|---|
| LogP | -0.46 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | FKFOJDYRQYJURJ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 3-(4-Morpholinylsulfonyl)aniline |
| 3-(morpholinosulfonyl)phenylamine |
| 4-(3-amino-benzenesulfonyl)-morpholine |
| 3-(Morpholinosulfonyl)aniline |
| Benzenamine, 3-(4-morpholinylsulfonyl)- |
| 4-(3-aminophenylsulfonyl)morpholine |
| MFCD02090909 |
| 3-(Morpholin-4-ylsulfonyl)aniline |
| 3-(morpholin-4-ylsulfonyl)phenylamine |
| 3-(morpholinosulphonyl)aniline |
| 3-(morpholine-4-sulfonyl)-phenylamine |
| 4-(3-amino-phenylsulfonyl)-morpholin |
