Introduction：Basic information about CAS 24906-77-2|4-(difluoromethylsulfonyl)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(difluoromethylsulfonyl)aniline |
|---|
| CAS Number | 24906-77-2 | Molecular Weight | 207.19800 |
|---|
| Density | 1.431g/cm3 | Boiling Point | 368.4ºC at 760mmHg |
|---|
| Molecular Formula | C7H7F2NO2S | Melting Point | 105-106ºC |
|---|
| MSDS | / | Flash Point | 176.6ºC |
|---|
Names
| Name | 4-(difluoromethylsulfonyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.431g/cm3 |
|---|
| Boiling Point | 368.4ºC at 760mmHg |
|---|
| Melting Point | 105-106ºC |
|---|
| Molecular Formula | C7H7F2NO2S |
|---|
| Molecular Weight | 207.19800 |
|---|
| Flash Point | 176.6ºC |
|---|
| Exact Mass | 207.01700 |
|---|
| PSA | 68.54000 |
|---|
| LogP | 2.92710 |
|---|
| Vapour Pressure | 1.28E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | OHQOPPCSAGDCDO-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(S(=O)(=O)C(F)F)cc1 |
|---|
Safety Information
| Risk Phrases | 20/21/22 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-(Difluoromethyl)sulfonylaniline |
| p-Difluormethylsulfonyl-anilin |
| 4-difluoromethanesulfonylaniline |
| 4-(difluoromethanesulphonyl)phenylamine |
| p-Aminophenyl-difluormethyl-sulfon |
| (4-Amino-phenyl)-difluormethyl-sulfon |
