Introduction:Basic information about CAS 375-02-0|Heptafluorobutyraldehyde hydrate, tech., including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Heptafluorobutyraldehyde hydrate, tech. |
|---|
| CAS Number | 375-02-0 | Molecular Weight | 200.055 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 95.0±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C4H3F7O | Melting Point | 61°C |
|---|
| MSDS | USA | Flash Point | 25.0±0.0 °C |
|---|
Names
| Name | 2,2,3,3,4,4,4-heptafluorobutanal |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 95.0±0.0 °C at 760 mmHg |
|---|
| Melting Point | 61°C |
|---|
| Molecular Formula | C4H3F7O |
|---|
| Molecular Weight | 200.055 |
|---|
| Flash Point | 25.0±0.0 °C |
|---|
| Exact Mass | 200.007217 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 1.81 |
|---|
| Vapour Pressure | 27.4±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.284 |
|---|
| InChIKey | IQJZGNJYXIIMGP-UHFFFAOYSA-N |
|---|
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2913000090 |
|---|
Customs
| HS Code | 2913000090 |
|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00150588 |
| Butyraldehyde,heptafluoro |
| Heptafluor-butyraldehyd |
| 1-Butanol, 2,2,3,3,4,4,4-heptafluoro- |
| 2,2,3,3,4,4,4-Heptafluoro-butanol |
| 2,2,3,3,4,4,4-Heptafluorobutan-1-ol |
| Butanal,heptafluoro |
| Heptafluorobutyraldehyde |
| Heptafluorobutyraldehyde,tech. |
| Perfluoropropyl carbinol |
| 2,2,3,3,4,4,4-heptafluorobutyraldehyde |
| heptafluorobutanal |
| EINECS 206-783-7 |
| 2,2,3,3,4,4,4-heptafluorobutoxide |
| 1H,1H-Heptafluoro-1-butanol |
| 2,2,3,3,4,4,4-Heptafluoro-1-butanol |