Introduction：Basic information about CAS 6251-01-0|2,2'-Naphthalene-2,6-diylidenedimalononitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-Naphthalene-2,6-diylidenedimalononitrile |
|---|
| CAS Number | 6251-01-0 | Molecular Weight | 254.246 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 311.6±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H6N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 129.4±21.8 °C |
|---|
Names
| Name | 2-[6-(dicyanomethylidene)naphthalen-2-ylidene]propanedinitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 311.6±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H6N4 |
|---|
| Molecular Weight | 254.246 |
|---|
| Flash Point | 129.4±21.8 °C |
|---|
| Exact Mass | 254.059250 |
|---|
| PSA | 95.16000 |
|---|
| LogP | 0.28 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | JLTPSDHKZGWXTD-UHFFFAOYSA-N |
|---|
| SMILES | N#CC(C#N)=c1ccc2cc(=C(C#N)C#N)ccc2c1 |
|---|
Synonyms
| 11,11,12,12-tetracyano-2,6-naphthoquinodimethan |
| 9,9,10,10-tetracyano-2,6-naphthoquinodimethane |
| 9,9,10,10-tetracyanonaphtho-2,6-quinodimethane |
| 11,11,12,12-Tetracyanonaphtho-2,6-quinodimethane |
| Tetracyano-2,6-naphthoquinodimethane |
| 11,11,12,12-tetracyano-2,6-naphthoquinodimethane |
| 2,2'-Naphthalene-2,6-diylidenedimalononitrile |
| 2,2'-(2,6-Naphthalenediylidene)dimalononitrile |
| TNAP |
| Propanedinitrile, 2,2'-(2,6-naphthalenediylidene)bis- |
