Introduction:Basic information about CAS 40306-75-0|3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid |
|---|
| CAS Number | 40306-75-0 | Molecular Weight | 246.24000 |
|---|
| Density | 1.686g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H10N2O5S | Melting Point | >300 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-Acetamido-5-amino-4-hydroxybenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.686g/cm3 |
|---|
| Melting Point | >300 °C(lit.) |
|---|
| Molecular Formula | C8H10N2O5S |
|---|
| Molecular Weight | 246.24000 |
|---|
| Exact Mass | 246.03100 |
|---|
| PSA | 138.10000 |
|---|
| LogP | 1.91450 |
|---|
| Index of Refraction | 1.681 |
|---|
| InChIKey | SFUJTLIHMWZDTL-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1cc(S(=O)(=O)O)cc(N)c1O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-acetamido-5-amino-4-hydroxybenzenesulfonic acid |
| MFCD00035909 |
| 3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid |
| EINECS 254-879-2 |