Introduction：Basic information about CAS 10190-68-8|DIRECTYELLOW27, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DIRECTYELLOW27 |
|---|
| CAS Number | 10190-68-8 | Molecular Weight | 662.62200 |
|---|
| Density | 1.59g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C25H20N4Na2O9S3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | direct yellow 27 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.59g/cm3 |
|---|
| Molecular Formula | C25H20N4Na2O9S3 |
|---|
| Molecular Weight | 662.62200 |
|---|
| Exact Mass | 662.01900 |
|---|
| PSA | 255.57000 |
|---|
| LogP | 6.83500 |
|---|
| Index of Refraction | 1.71 |
|---|
| InChIKey | WLDNGJFRVWQASY-UHFFFAOYSA-L |
|---|
| SMILES | COc1ccccc1NC(=O)C(N=Nc1ccc(-c2nc3ccc(C)c(S(=O)(=O)[O-])c3s2)cc1S(=O)(=O)[O-])C(C)=O.[Na+].[Na+] |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 3204140000 |
|---|
Customs
Synonyms
| Fast Yellow 5GL |
| EINECS 233-461-3 |
| Condirect Yellow BL |
| C.I.Directyellow27 |
| SolarFlavine5G |
| Ka-yarusYellow5G |
| SiriusSupraYellow5G |
| Triamin Yellow 5G |
| MFCD00005778 |
| DirectFlavine5G |
