Introduction：Basic information about CAS 120-52-5|2,5-Cyclohexadiene-1,4-dione,1,4-bis(O-benzoyloxime), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Cyclohexadiene-1,4-dione,1,4-bis(O-benzoyloxime) |
|---|
| CAS Number | 120-52-5 | Molecular Weight | 346.336 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 467.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H14N2O4 | Melting Point | -47 °C |
|---|
| MSDS | / | Flash Point | 190.0±25.9 °C |
|---|
Names
| Name | 4,4-Dibenzoylquinone Dioxime |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 467.3±55.0 °C at 760 mmHg |
|---|
| Melting Point | -47 °C |
|---|
| Molecular Formula | C20H14N2O4 |
|---|
| Molecular Weight | 346.336 |
|---|
| Flash Point | 190.0±25.9 °C |
|---|
| Exact Mass | 346.095367 |
|---|
| PSA | 77.32000 |
|---|
| LogP | 4.90 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | WMVSVUVZSYRWIY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(ON=C1C=CC(=NOC(=O)c2ccccc2)C=C1)c1ccccc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
Synonyms
| [(4-benzoyloxyiminocyclohexa-2,5-dien-1-ylidene)amino] benzoate |
| [2,5-Cyclohexadiene-1,4-diylidenebis(azanylylideneoxy)]bis(phenylmethanone) |
| EINECS 204-403-4 |
| Benzoquinone O,O-dibenzoyl dioxime |
| 4,4'-Dibenzoylquinone dioxime |
| 2,5-Cyclohexadiene-1,4-dione, bis(O-benzoyloxime) |
| [Cyclohexa-2,5-diene-1,4-diylidenebis(nitrilooxy)]bis(phenylmethanone) |
| MFCD00045557 |
