Introduction：Basic information about CAS 26914-52-3|Toluene ethylsulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Toluene ethylsulfonamide |
|---|
| CAS Number | 26914-52-3 | Molecular Weight | 398.54000 |
|---|
| Density | 1.21 | Boiling Point | / |
|---|
| Molecular Formula | C18H26N2O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193 °C |
|---|
Names
| Name | Toluene ethylsulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21 |
|---|
| Molecular Formula | C18H26N2O4S2 |
|---|
| Molecular Weight | 398.54000 |
|---|
| Flash Point | 193 °C |
|---|
| Exact Mass | 398.13300 |
|---|
| PSA | 109.10000 |
|---|
| LogP | 5.52980 |
|---|
| InChIKey | IDLSDSKPHLCUTN-UHFFFAOYSA-N |
|---|
| SMILES | CCNS(=O)(=O)c1ccc(C)cc1.CCNS(=O)(=O)c1ccccc1C |
|---|
| Water Solubility | <0.01 g/100 mL at 18 ºC |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R68:Possible risk of irreversible effects. R36/37:Irritating to eyes and respiratory system . R22:Harmful if swallowed. |
|---|
| Safety Phrases | S36/37-S26 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N-ethyl-o(or p)-toluenesulphonamide |
| MFCD00152499 |
| N-ETHYLTOLUENESULFONAMIDE |
| Ethyltoulenesulfonamide |
| Plasticizer 8 |
| N-ethyl-o(or p)-toluenesulfonamide |
| santicizer 8 |
| N-Ethyltoluene-4-Sulfonamide |
| N-ETHYL-2(OR4)-TOLUENESULFONAMIDE |
| EINECS 232-465-2 |
