Introduction:Basic information about CAS 41472-49-5|N-[2-(4-Sulfamoylphenyl)ethyl]acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-(4-Sulfamoylphenyl)ethyl]acetamide |
|---|
| CAS Number | 41472-49-5 | Molecular Weight | 242.295 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 387.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14N2O3S | Melting Point | 168-174°C |
|---|
| MSDS | / | Flash Point | 188.1ºC |
|---|
Names
| Name | N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 387.4ºC at 760 mmHg |
|---|
| Melting Point | 168-174°C |
|---|
| Molecular Formula | C10H14N2O3S |
|---|
| Molecular Weight | 242.295 |
|---|
| Flash Point | 188.1ºC |
|---|
| Exact Mass | 242.072510 |
|---|
| PSA | 97.64000 |
|---|
| LogP | -0.68 |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | IIMGUEXQORZTID-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | R34:Causes burns. |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3265 8/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-(2-acetylamino-ethyl)-benzenesulfonic acid amide |
| 4-(2-Acetylamino-aethyl)-benzolsulfonsaeure-amid |
| Acetamide, N-[[4-(2-aminoethyl)phenyl]sulfonyl]- |
| 1-(2-Acetamino-aethyl)-benzolsulfonamid-(4) |
| N-Acetyl-4-(2-aminoethyl)-benzenesulfonamide |
| N-{[4-(2-Aminoethyl)phenyl]sulfonyl}acetamide |
| N-[2-(4-Sulfamoylphenyl)ethyl]acetamide |
| M25 |
| 4-(N-acetyl-2-aminoethyl)benzenesulfonamide |
| N-(P-SULFAMOYLPHENETHYL)ACETAMIDE |
| Acetamide, N-[2-[4-(aminosulfonyl)phenyl]ethyl]- |
| N-[2-[4-(Aminosulfonyl)phenyl]ethyl]-acetamide |
| EINECS 255-386-5 |
| 2nns |
| N-(4-Sulfamoylphenethyl)acetamide |
| N-(4-Sulfamoyl-phenaethyl)-acetamid |
| 2nmx |
| MFCD00193755 |