Introduction:Basic information about CAS 28860-96-0|DL-3-(3,4-Dimethoxyphenyl)-2-methyl-2-hydrazine propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DL-3-(3,4-Dimethoxyphenyl)-2-methyl-2-hydrazine propionic acid |
|---|
| CAS Number | 28860-96-0 | Molecular Weight | 254.282 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 451.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.5±28.7 °C |
|---|
Names
| Name | 3-(3,4-dimethoxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 451.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18N2O4 |
|---|
| Molecular Weight | 254.282 |
|---|
| Flash Point | 226.5±28.7 °C |
|---|
| Exact Mass | 254.126663 |
|---|
| PSA | 93.81000 |
|---|
| LogP | 0.88 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.550 |
|---|
| InChIKey | RPCRUCVXKKSQBD-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CC(C)(NN)C(=O)O)cc1OC |
|---|
Synonyms
| 3-(3,4-Dimethoxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
| MFCD08063342 |
| I047 |
| DL-3-(3,4-Dimethoxyphenyl)-2-methyl-2-hydrazine propionic acid |
| Benzenepropanoic acid, α-hydrazinyl-3,4-dimethoxy-α-methyl- |
| 3-(3,4-Dimethoxyphenyl)-2-hydrazino-2-methylpropanoic acid |