Introduction：Basic information about CAS 764667-64-3|5-(1-Hydroxy-2-(2,4,5-trifluorophenyl)ethylidene)-2,2-dimethyl-1,3-dioxane-4,, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(1-Hydroxy-2-(2,4,5-trifluorophenyl)ethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|
| CAS Number | 764667-64-3 | Molecular Weight | 316.229 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 489.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11F3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 249.6±28.7 °C |
|---|
Names
| Name | 5-[1-hydroxy-2-(2,4,5-trifluorophenyl)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 489.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11F3O5 |
|---|
| Molecular Weight | 316.229 |
|---|
| Flash Point | 249.6±28.7 °C |
|---|
| Exact Mass | 316.055847 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 1.01 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | COUGIGFQGFTRPG-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OC(=O)C(=C(O)Cc2cc(F)c(F)cc2F)C(=O)O1 |
|---|
Synonyms
| 1,3-Dioxane-4,6-dione, 5-[1-hydroxy-2-(2,4,5-trifluorophenyl)ethylidene]-2,2-dimethyl- |
| 5-[1-hydroxy-2-(2,4,5-trifluorophenyl)ethylidine]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| 2,2-dimethyl-5-[(2,4,5-trifluorophenyl)acetyl]-1,3-dioxan-4,6-dione |
| 5-[1-Hydroxy-2-(2,4,5-trifluorophenyl)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| 5-(1-hydroxy-2-(2,4,5-trifluorophenyl)ethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
