Introduction：Basic information about CAS 298187-48-1|2-(chloromethyl)-5-(3-methyl-4-nitrophenyl)-1,3,4-oxadiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(chloromethyl)-5-(3-methyl-4-nitrophenyl)-1,3,4-oxadiazole |
|---|
| CAS Number | 298187-48-1 | Molecular Weight | 253.64200 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 418.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H8ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.2ºC |
|---|
Names
| Name | 2-(chloromethyl)-5-(3-methyl-4-nitrophenyl)-1,3,4-oxadiazole |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 418.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H8ClN3O3 |
|---|
| Molecular Weight | 253.64200 |
|---|
| Flash Point | 207.2ºC |
|---|
| Exact Mass | 253.02500 |
|---|
| PSA | 84.74000 |
|---|
| LogP | 3.21520 |
|---|
| Vapour Pressure | 7.68E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | CTSDFOQGUVRPGN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(-c2nnc(CCl)o2)ccc1[N+](=O)[O-] |
|---|
