Introduction：Basic information about CAS 286430-62-4|2-(dimethylamino)-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(dimethylamino)-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|
| CAS Number | 286430-62-4 | Molecular Weight | 297.29900 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 432.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10F3N3S | Melting Point | 118ºC |
|---|
| MSDS | / | Flash Point | 215.2ºC |
|---|
Names
| Name | 2-(dimethylamino)-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 432.3ºC at 760 mmHg |
|---|
| Melting Point | 118ºC |
|---|
| Molecular Formula | C13H10F3N3S |
|---|
| Molecular Weight | 297.29900 |
|---|
| Flash Point | 215.2ºC |
|---|
| Exact Mass | 297.05500 |
|---|
| PSA | 68.16000 |
|---|
| LogP | 3.76658 |
|---|
| Vapour Pressure | 1.12E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | BPQKYSXGXIFVQQ-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1nc(-c2cccs2)cc(C(F)(F)F)c1C#N |
|---|
Synonyms
| HMS2809D04 |
| CCG-1712 |
| 2-(dimethylamino)-6-(2-thienyl)-4-(trifluoromethyl)nicotinonitrile |
