Introduction：Basic information about CAS 17329-87-2|2-Chloro-4'-nitroacetanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-4'-nitroacetanilide |
|---|
| CAS Number | 17329-87-2 | Molecular Weight | 214.60600 |
|---|
| Density | 1.472 g/cm3 | Boiling Point | 439.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7ClN2O3 | Melting Point | 185 - 186ºC |
|---|
| MSDS | / | Flash Point | 219.6ºC |
|---|
Names
| Name | 2-chloro-N-(4-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.472 g/cm3 |
|---|
| Boiling Point | 439.4ºC at 760 mmHg |
|---|
| Melting Point | 185 - 186ºC |
|---|
| Molecular Formula | C8H7ClN2O3 |
|---|
| Molecular Weight | 214.60600 |
|---|
| Flash Point | 219.6ºC |
|---|
| Exact Mass | 214.01500 |
|---|
| PSA | 74.92000 |
|---|
| LogP | 2.36830 |
|---|
| Vapour Pressure | 6.39E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | AZURFBCEYQYATI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCl)Nc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(4-nitrophenyl)-2-chloroacetamide |
| Acetanilide,2-chloro-4'-nitro |
| N1-(4-Nitrophenyl)-2-chloroacetamide |
| 3-chloro-N-(3-nitrophenyl)propanamide |
| p-nitro-N-chloroacetylaniline |
| Acetamide,2-chloro-N-(4-nitrophenyl) |
| 2-Chloro-4'-nitroacetanilide |
| 2-Chloro-N-(4-nitrophenyl)-acetamide |
