Introduction：Basic information about CAS 2706-92-5|6-Chloro-9H-purine-2-sulfonyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-9H-purine-2-sulfonyl fluoride |
|---|
| CAS Number | 2706-92-5 | Molecular Weight | 236.61100 |
|---|
| Density | 2.2g/cm3 | Boiling Point | 383ºC at 760mmHg |
|---|
| Molecular Formula | C5H2ClFN4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.4ºC |
|---|
Names
| Name | 6-chloro-7H-purine-2-sulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.2g/cm3 |
|---|
| Boiling Point | 383ºC at 760mmHg |
|---|
| Molecular Formula | C5H2ClFN4O2S |
|---|
| Molecular Weight | 236.61100 |
|---|
| Flash Point | 185.4ºC |
|---|
| Exact Mass | 235.95700 |
|---|
| PSA | 96.98000 |
|---|
| LogP | 1.74530 |
|---|
| Vapour Pressure | 1.25E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | QVUAWHQMKAWAFB-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(F)c1nc(Cl)c2[nH]cnc2n1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-chloro-7(9)H-purine-2-sulfonyl fluoride |
| 2-fluorosulfonyl-6-chloropurine |
| 6-Chlor-purin-2-sulfonylfluorid |
| 6-Chlor-purinsulfonsaeure-(2)-fluorid |
| 6-Chloro-1H-Purine-2-sulfonyl fluoride |
| 6-chloranyl-7H-purine-2-sulfonyl fluoride |
| 6-chloro-9H-purine-2-sulfonyl fluoride |
