Introduction:Basic information about CAS 7253-04-5|1-(2,5-dichloro-4-sulfo-phenyl)-5-oxo-4H-pyrazole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2,5-dichloro-4-sulfo-phenyl)-5-oxo-4H-pyrazole-3-carboxylic acid |
|---|
| CAS Number | 7253-04-5 | Molecular Weight | 353.13500 |
|---|
| Density | 1.95g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H6Cl2N2O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-(2:5-Dichloro-4-Sulphophenyl) -3- Methyl -5- Pyrazolone |
|---|
Chemical & Physical Properties
| Density | 1.95g/cm3 |
|---|
| Molecular Formula | C10H6Cl2N2O6S |
|---|
| Molecular Weight | 353.13500 |
|---|
| Exact Mass | 351.93200 |
|---|
| PSA | 132.72000 |
|---|
| LogP | 1.99880 |
|---|
| Index of Refraction | 1.743 |
|---|
| InChIKey | YVFMPXVMGPZCRS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1=NN(c2cc(Cl)c(S(=O)(=O)O)cc2Cl)C(=O)C1 |
|---|