Introduction：Basic information about CAS 221349-76-4|2-Methoxy-3-nitroisonicotinaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methoxy-3-nitroisonicotinaldehyde |
|---|
| CAS Number | 221349-76-4 | Molecular Weight | 182.133 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 338.9±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.7±27.9 °C |
|---|
Names
| Name | 2-methoxy-3-nitropyridine-4-carbaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 338.9±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6N2O4 |
|---|
| Molecular Weight | 182.133 |
|---|
| Flash Point | 158.7±27.9 °C |
|---|
| Exact Mass | 182.032761 |
|---|
| PSA | 85.01000 |
|---|
| LogP | 1.19 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | ATPIZGMDDYXDKM-UHFFFAOYSA-N |
|---|
| SMILES | COc1nccc(C=O)c1[N+](=O)[O-] |
|---|
Synonyms
| 2-Methoxy-3-nitroisonicotinaldehyde |
| 4-Pyridinecarboxaldehyde, 2-methoxy-3-nitro- |
| 2-Methoxy-3-nitropyridine-4-carboxaldehyde |
| QC-6698 |
