Introduction:Basic information about CAS 56183-63-2|BIS(DIISOPROPYLAMINO)CHLOROPHOSPHINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | BIS(DIISOPROPYLAMINO)CHLOROPHOSPHINE |
|---|
| CAS Number | 56183-63-2 | Molecular Weight | 266.791 |
|---|
| Density | / | Boiling Point | 290.9±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H28ClN2P | Melting Point | 100-104 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 129.8±22.6 °C |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | Bis(diisopropylamino)chlorophosphine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 290.9±23.0 °C at 760 mmHg |
|---|
| Melting Point | 100-104 °C(lit.) |
|---|
| Molecular Formula | C12H28ClN2P |
|---|
| Molecular Weight | 266.791 |
|---|
| Flash Point | 129.8±22.6 °C |
|---|
| Exact Mass | 266.167877 |
|---|
| PSA | 20.07000 |
|---|
| LogP | 4.91 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| InChIKey | FEHUTHGOLLQBNW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)N(C(C)C)P(Cl)N(C(C)C)C(C)C |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Supplemental HS | Reacts violently with water. |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | 14-34 |
|---|
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 1 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
Synonyms
| N,N,N',N'-tetrapropan-2-ylphosphorodiamidous chloride |
| N-[chloro-[di(propan-2-yl)amino]phosphanyl]-N-propan-2-ylpropan-2-amine |
| MFCD00061482 |
| N,N,N',N'-Tetraisopropylphosphorodiamidous chloride |
| Phosphorodiamidous chloride, N,N,N',N'-tetrakis(1-methylethyl)- |