Introduction：Basic information about CAS 603-71-4|2-nitromesitylene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-nitromesitylene |
|---|
| CAS Number | 603-71-4 | Molecular Weight | 165.18900 |
|---|
| Density | 1.1g/cm3 | Boiling Point | 255 °C(lit.) |
|---|
| Molecular Formula | C9H11NO2 | Melting Point | 41-44 °C(lit.) |
|---|
| MSDS | / | Flash Point | 187 °F |
|---|
Names
| Name | 1,3,5-trimethyl-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1g/cm3 |
|---|
| Boiling Point | 255 °C(lit.) |
|---|
| Melting Point | 41-44 °C(lit.) |
|---|
| Molecular Formula | C9H11NO2 |
|---|
| Molecular Weight | 165.18900 |
|---|
| Flash Point | 187 °F |
|---|
| Exact Mass | 165.07900 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.04320 |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | SCEKDQTVGHRSNS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)c1 |
|---|
Safety Information
| Hazard Codes | F,Xn |
|---|
| Risk Phrases | 11-20/21/22-36/37/38 |
|---|
| Safety Phrases | S16-S26-S36/37/39 |
|---|
| RIDADR | 1325 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 4.1 |
|---|
| HS Code | 2904209090 |
|---|
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,3,5-trimethyl-2-nitro-benzene |
| nitromesitylene |
| 2-nitromesitylene |
| Mesitylene,2-nitro |
| MFCD00007170 |
| 2-nitro-1,3,5-trimethylbenzene |
| EINECS 210-054-9 |
| 1-nitro-2,4,6-tri-methyl benzene |
| 1,3,5-Trimethyl-2-nitro-benzol |
| Benzene,1,3,5-trimethyl-2-nitro |
| Mononitromesitylene |
