Introduction:Basic information about CAS 2367-02-4|4-(trifluoromethyl)diphenyl ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(trifluoromethyl)diphenyl ether |
|---|
| CAS Number | 2367-02-4 | Molecular Weight | 238.20500 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 180°C 10mm |
|---|
| Molecular Formula | C13H9F3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180°C/10mm |
|---|
Names
| Name | 1-phenoxy-4-(trifluoromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 180°C 10mm |
|---|
| Molecular Formula | C13H9F3O |
|---|
| Molecular Weight | 238.20500 |
|---|
| Flash Point | 180°C/10mm |
|---|
| Exact Mass | 238.06100 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 4.49770 |
|---|
| Vapour Pressure | 0.0167mmHg at 25°C |
|---|
| Index of Refraction | 1.5135 |
|---|
| InChIKey | UZJUDUZMPNCXPF-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(Oc2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-trifluoromethyldiphenyl ether |
| phenyl 4-trifluoromethylphenyl ether |
| 1-phenoxy-4-trifluoromethylbenzene |
| 4-phenoxybenzylidyne trifluoride |
| MFCD01631641 |
| 4-phenoxytrifluoromethylbenzene |