Introduction:Basic information about CAS 889939-00-8|5-(1-hydroxyethyl)-3-(3-trifluoroethyl)-isoxazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(1-hydroxyethyl)-3-(3-trifluoroethyl)-isoxazole |
|---|
| CAS Number | 889939-00-8 | Molecular Weight | 257.20900 |
|---|
| Density | 1.316g/cm3 | Boiling Point | 371.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.7ºC |
|---|
Names
| Name | 5-(1-hydroxyethyl)-3-(3-trifluoroethyl)-isoxazole |
|---|
Chemical & Physical Properties
| Density | 1.316g/cm3 |
|---|
| Boiling Point | 371.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10F3NO2 |
|---|
| Molecular Weight | 257.20900 |
|---|
| Flash Point | 178.7ºC |
|---|
| Exact Mass | 257.06600 |
|---|
| PSA | 46.26000 |
|---|
| LogP | 3.41370 |
|---|
| Index of Refraction | 1.498 |
|---|
| InChIKey | JXEFDHOZDUDKFJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)c1cc(-c2cccc(C(F)(F)F)c2)no1 |
|---|