Introduction:Basic information about CAS 56962-08-4|4,5-Dichlorophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-Dichlorophthalic acid |
|---|
| CAS Number | 56962-08-4 | Molecular Weight | 235.02100 |
|---|
| Density | 1.698g/cm3 | Boiling Point | 422.1ºC at 760mmHg |
|---|
| Molecular Formula | C8H4Cl2O4 | Melting Point | 198-200 °C (dec.)(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 209.1ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4,5-Dichlorophthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.698g/cm3 |
|---|
| Boiling Point | 422.1ºC at 760mmHg |
|---|
| Melting Point | 198-200 °C (dec.)(lit.) |
|---|
| Molecular Formula | C8H4Cl2O4 |
|---|
| Molecular Weight | 235.02100 |
|---|
| Flash Point | 209.1ºC |
|---|
| Exact Mass | 233.94900 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.38980 |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | FDOQKGWUMUEJLX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Cl)c(Cl)cc1C(=O)O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S22-S24/25-S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00002493 |
| EINECS 260-478-3 |
| 4,5-dichlorophthalic acid |