Introduction：Basic information about CAS 105528-25-4|5,9,14,18,23,27,32,36-OCTABUTOXY- 2,3-NAPHTHALOCYANINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,9,14,18,23,27,32,36-OCTABUTOXY- 2,3-NAPHTHALOCYANINE |
|---|
| CAS Number | 105528-25-4 | Molecular Weight | 1291.62000 |
|---|
| Density | 1.215 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C80H90N8O8 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | 5,9,14,18,23,27,32,36-octa-n-butoxy-2,3-naphthalocyanine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.215 g/cm3 |
|---|
| Molecular Formula | C80H90N8O8 |
|---|
| Molecular Weight | 1291.62000 |
|---|
| Exact Mass | 1290.69000 |
|---|
| PSA | 179.58000 |
|---|
| LogP | 15.93680 |
|---|
| InChIKey | BFXKASLQHBYWIJ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1c2c(c(OCCCC)c3ccccc13)-c1nc-2nc2[nH]c(nc3nc(nc4[nH]c(n1)c1c(OCCCC)c5ccccc5c(OCCCC)c41)-c1c-3c(OCCCC)c3ccccc3c1OCCCC)c1c(OCCCC)c3ccccc3c(OCCCC)c21 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 5,9,13-trimethyl-tetradecanoic acid |
| 5,9,13-Trimethyl-tetradecansaeure |
| 5,9,14,18,23,27,32,36-octabutoxy-2,3-naphthalocyanine |
| octabutoxynaphthalocyanine |
| MFCD00192363 |
| Hexahydro-farnesyl-essigsaeure |
| Tetradecanoic acid,5,9,13-trimethyl |
| 5,9,13-Trimethylmyristicacid |
