Introduction:Basic information about CAS 101736-22-5|(5-Methyl-2-phenylthiazole-4-yl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (5-Methyl-2-phenylthiazole-4-yl)acetic acid |
|---|
| CAS Number | 101736-22-5 | Molecular Weight | 233.286 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 435.1±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H11NO2S | Melting Point | 135-137ºC |
|---|
| MSDS | / | Flash Point | 216.9±26.5 °C |
|---|
Names
| Name | 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 435.1±37.0 °C at 760 mmHg |
|---|
| Melting Point | 135-137ºC |
|---|
| Molecular Formula | C12H11NO2S |
|---|
| Molecular Weight | 233.286 |
|---|
| Flash Point | 216.9±26.5 °C |
|---|
| Exact Mass | 233.051056 |
|---|
| PSA | 78.43000 |
|---|
| LogP | 2.99 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | SZYXURFSAUXFNT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1sc(-c2ccccc2)nc1CC(=O)O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| (5-Methyl-2-phenyl-1,3-thiazol-4-yl)acetic acid |
| (5-Methyl-2-phenylthiazole-4-yl)acetic acid |
| 2-(3,5-DIMETHYL-PYRAZOL-1-YL)-PHENYLAMINE |
| MFCD00277218 |
| (5-Methyl-2-phenyl-thiazol-4-yl)-essigsaeure |
| methylphenylthiazolylaceticacid |
| (5-methyl-2-phenyl-thiazol-4-yl)-acetic acid |
| 4-Thiazoleacetic acid, 5-methyl-2-phenyl- |
| 4-Thiazoleacetic acid,5-methyl-2-phenyl |