Introduction:Basic information about CAS 24675-13-6|4-(2-Benzooxazol-2-ylethenyl)-N,N-dimethylaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-Benzooxazol-2-ylethenyl)-N,N-dimethylaniline |
|---|
| CAS Number | 24675-13-6 | Molecular Weight | 264.32200 |
|---|
| Density | 1.197g/cm3 | Boiling Point | 451.5ºC at 760mmHg |
|---|
| Molecular Formula | C17H16N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.9ºC |
|---|
Names
| Name | 4-(2-benzooxazol-2-ylethenyl)-N,N-dimethyl-aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.197g/cm3 |
|---|
| Boiling Point | 451.5ºC at 760mmHg |
|---|
| Molecular Formula | C17H16N2O |
|---|
| Molecular Weight | 264.32200 |
|---|
| Flash Point | 226.9ºC |
|---|
| Exact Mass | 264.12600 |
|---|
| PSA | 29.27000 |
|---|
| LogP | 4.06420 |
|---|
| Vapour Pressure | 2.41E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.709 |
|---|
| InChIKey | DQOPDYYQICTYEY-FMIVXFBMSA-N |
|---|
| SMILES | CN(C)c1ccc(C=Cc2nc3ccccc3o2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-(p-(Dimethylamino)styryl)-1-ethylbenzothiazolyl iodide |
| Benzothiazolium,2-[p-(dimethylamino)styryl]-3-ethyl-,iodide (8CI) |
| (E)-2-(4-(dimethylamino)styryl)-3-methylbenzo[d]oxazol-3-ium iodide |
| 1-(Benzoxazol-2-yl)-2-(p-dimethylamino-phenyl)ethylen |
| 3-Aethyl-2-(4-dimethylamino-styryl)-benzothiazolium,Jodid |
| 2-(4-Dimethylamino-styryl)-3-methyl-benzoxazolium,Jodid |
| 2-[p-(Dimethylamino)styryl]-3-ethylbenzothiazoliumiodide (6CI,7CI) |
| Benzothiazolium,2-[2-[4-(dimethylamino)phenyl]ethenyl]-3-ethyl-,iodide (9CI) |
| Benzothiazolium,2-[2-[4-(dimethylamino)phenyl]ethenyl]-3-ethyl-,iodide (1:1) |
| 2-(4-dimethylamino-styryl)-3-methyl-benzoxazolium,iodide |
| 3-ethyl-2-(4-dimethylamino-styryl)-benzothiazolium,iodide |
| 1-(Benzoxazolyl-2)-2-(4-dimethylamino-phenyl)-aethylen |
| 3-Aethyl-2-<4-dimethylamino-styryl>-benzthiazolium |
| 4-(2-benzooxazol-2-yl-vinyl)-N,N-dimethyl-aniline |
| DASBTI |
| 2-(p-Dimethylaminostyryl)benzothiazole ethiodide |
| 2-(4-dimethylamino-styryl)-3-ethyl-benzothiazolium,iodide |
| 2-(4-dimethylaminostyryl)benzoxazole |